C7H9N3O3 — CID 169488835
2,3,6,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-1,4,7-trione (PubChem CID 169488835) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2,3,6,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-1,4,7-trione.
| Compound Name | 2,3,6,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-1,4,7-trione |
|---|---|
| PubChem CID | 169488835 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2,3,6,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-1,4,7-trione |
| SMILES | O=C1CN2C(=O)CNC(=O)C2CN1 |
| InChI | InChI=1S/C7H9N3O3/c11-5-3-10-4(1-8-5)7(13)9-2-6(10)12/h4H,1-3H2,(H,8,11)(H,9,13) |
| InChIKey | YYLHBBUJTCGCBT-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |