C14H12F5N — CID 169489213
1-[2-ethynyl-5-(trifluoromethyl)phenyl]-4,4-difluoropiperidine (PubChem CID 169489213) has the molecular formula C14H12F5N and a molecular weight of 289.25 g/mol. Its IUPAC name is 1-[2-ethynyl-5-(trifluoromethyl)phenyl]-4,4-difluoropiperidine.
| Compound Name | 1-[2-ethynyl-5-(trifluoromethyl)phenyl]-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 169489213 |
| Molecular Formula | C14H12F5N |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-[2-ethynyl-5-(trifluoromethyl)phenyl]-4,4-difluoropiperidine |
| SMILES | C#Cc1ccc(C(F)(F)F)cc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H12F5N/c1-2-10-3-4-11(14(17,18)19)9-12(10)20-7-5-13(15,16)6-8-20/h1,3-4,9H,5-8H2 |
| InChIKey | IUGJCHUPQRFKHH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|