About (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate
(2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate (PubChem CID 169489342) has the molecular formula C15H16O3S
and a molecular weight of 276.36 g/mol. Its IUPAC name is (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate.
Molecular Properties
| Compound Name | (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate |
| PubChem CID | 169489342 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate |
| SMILES | CCC1=C(OC(=O)c2ccc(SC)cc2)C(=O)CC1 |
| InChI | InChI=1S/C15H16O3S/c1-3-10-6-9-13(16)14(10)18-15(17)11-4-7-12(19-2)8-5-11/h4-5,7-8H,3,6,9H2,1-2H3 |
| InChIKey | NGLAPEAVBCHMMX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate?
The IUPAC name of (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate (CID 169489342) is (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate.
What is the SMILES notation for (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate?
The canonical SMILES for (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate is CCC1=C(OC(=O)c2ccc(SC)cc2)C(=O)CC1.
What is the InChIKey of (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate?
The InChIKey is NGLAPEAVBCHMMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O3S/c1-3-10-6-9-13(16)14(10)18-15(17)11-4-7-12(19-2)8-5-11/h4-5,7-8H,3,6,9H2,1-2H3.
What are the key properties of (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate?
(2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate has a molecular weight of 276.36 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-5-oxocyclopenten-1-yl) 4-methylsulfanylbenzoate is sourced from PubChem (CID 169489342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).