C12H14FN3O — CID 169489612
6-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 169489612) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | 6-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 169489612 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 6-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | O=C1NC2CNC(c3ccc(F)cc3)CC2N1 |
| InChI | InChI=1S/C12H14FN3O/c13-8-3-1-7(2-4-8)9-5-10-11(6-14-9)16-12(17)15-10/h1-4,9-11,14H,5-6H2,(H2,15,16,17) |
| InChIKey | OZHOVQSFTJETGY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |