C16H22N4O — CID 169489713
5-[(5-amino-2,3-dihydroindol-1-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one (PubChem CID 169489713) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-[(5-amino-2,3-dihydroindol-1-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one.
| Compound Name | 5-[(5-amino-2,3-dihydroindol-1-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 169489713 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-[(5-amino-2,3-dihydroindol-1-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one |
| SMILES | Nc1ccc2c(c1)CCN2CC1CCC2NC(=O)NC2C1 |
| InChI | InChI=1S/C16H22N4O/c17-12-2-4-15-11(8-12)5-6-20(15)9-10-1-3-13-14(7-10)19-16(21)18-13/h2,4,8,10,13-14H,1,3,5-7,9,17H2,(H2,18,19,21) |
| InChIKey | XGZPOJKZTGDDPF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|