C29H28F4N4O4 — CID 169489768
N-[(3S)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 169489768) has the molecular formula C29H28F4N4O4 and a molecular weight of 572.56 g/mol. Its IUPAC name is N-[(3S)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3S)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 169489768 |
| Molecular Formula | C29H28F4N4O4 |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | N-[(3S)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)[C@H](NC(=O)C(F)(F)F)C(=O)CC(Cc1ccc(F)cc1)C(=O)N1C[C@]2(C[C@H]1C#N)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H28F4N4O4/c1-16(2)24(36-27(41)29(31,32)33)23(38)12-18(11-17-7-9-19(30)10-8-17)25(39)37-15-28(13-20(37)14-34)21-5-3-4-6-22(21)35-26(28)40/h3-10,16,18,20,24H,11-13,15H2,1-2H3,(H,35,40)(H,36,41)/t18?,20-,24-,28-/m0/s1 |
| InChIKey | JRWCAGKSAAUPNY-TUXOFTQXSA-N |
| XLogP | 3.66 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |