C28H31N5O4 — CID 169489922
4-[4-[4-hydroxy-4-[(4-oxo-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl]piperidine-1-carbonyl]phenyl]-N,N-dimethylbenzamide (PubChem CID 169489922) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 4-[4-[4-hydroxy-4-[(4-oxo-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl]piperidine-1-carbonyl]phenyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[4-[4-hydroxy-4-[(4-oxo-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl]piperidine-1-carbonyl]phenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 169489922 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 4-[4-[4-hydroxy-4-[(4-oxo-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl]piperidine-1-carbonyl]phenyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2ccc(C(=O)N3CCC(O)(CN4CNn5cccc5C4=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H31N5O4/c1-30(2)25(34)22-9-5-20(6-10-22)21-7-11-23(12-8-21)26(35)31-16-13-28(37,14-17-31)18-32-19-29-33-15-3-4-24(33)27(32)36/h3-12,15,29,37H,13-14,16-19H2,1-2H3 |
| InChIKey | NCRIORNUDMFTCQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |