C29H41NO — CID 169490211
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(E,2R)-4-(6-methyl-2-pyridinyl)but-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169490211) has the molecular formula C29H41NO and a molecular weight of 419.65 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(E,2R)-4-(6-methyl-2-pyridinyl)but-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(E,2R)-4-(6-methyl-2-pyridinyl)but-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169490211 |
| Molecular Formula | C29H41NO |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.32 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(E,2R)-4-(6-methyl-2-pyridinyl)but-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | Cc1cccc(/C=C/[C@@H](C)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)n1 |
| InChI | InChI=1S/C29H41NO/c1-19(8-10-22-7-5-6-20(2)30-22)25-12-13-26-24-11-9-21-18-23(31)14-16-28(21,3)27(24)15-17-29(25,26)4/h5-10,19,23-27,31H,11-18H2,1-4H3/b10-8+/t19-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | TZUADTUVEYZNOH-DUYRDQBQSA-N |
| XLogP | 6.98 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|