C15H19NO2 — CID 169490532
ethyl (Z)-2-cyano-3-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]prop-2-enoate (PubChem CID 169490532) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]prop-2-enoate |
|---|---|
| PubChem CID | 169490532 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\C1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C15H19NO2/c1-4-18-14(17)11(9-16)7-10-5-6-12-8-13(10)15(12,2)3/h5,7,12-13H,4,6,8H2,1-3H3/b11-7-/t12-,13-/m0/s1 |
| InChIKey | WKECESNHCMMIFH-LVRHIEOCSA-N |
| XLogP | 2.99 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|