C19H29NO2 — CID 169490564
ethyl 2-cyano-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentanoate (PubChem CID 169490564) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is ethyl 2-cyano-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentanoate.
| Compound Name | ethyl 2-cyano-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 169490564 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethyl 2-cyano-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentanoate |
| SMILES | CCOC(=O)C(C#N)(CC1=CC[C@H]2C[C@@H]1C2(C)C)CC(C)C |
| InChI | InChI=1S/C19H29NO2/c1-6-22-17(21)19(12-20,10-13(2)3)11-14-7-8-15-9-16(14)18(15,4)5/h7,13,15-16H,6,8-11H2,1-5H3/t15-,16-,19?/m0/s1 |
| InChIKey | SQCFQNYCOJEEMJ-NRAVZPKASA-N |
| XLogP | 4.49 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|