C36H26F6N2O4S2 — CID 169490679
2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(4-nitrophenyl)ethynyl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 169490679) has the molecular formula C36H26F6N2O4S2 and a molecular weight of 728.74 g/mol. Its IUPAC name is 2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(4-nitrophenyl)ethynyl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(4-nitrophenyl)ethynyl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 169490679 |
| Molecular Formula | C36H26F6N2O4S2 |
| Molecular Weight | 728.74 g/mol |
| Exact Mass | 728.12 |
| IUPAC Name | 2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(4-nitrophenyl)ethynyl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | Cc1sc(-c2ccc(N(CCO)CCO)cc2)cc1C1=C(c2c(C#Cc3ccc([N+](=O)[O-])cc3)sc3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C36H26F6N2O4S2/c1-21-27(20-30(49-21)23-9-13-24(14-10-23)43(16-18-45)17-19-46)32-33(35(39,40)36(41,42)34(32,37)38)31-26-4-2-3-5-28(26)50-29(31)15-8-22-6-11-25(12-7-22)44(47)48/h2-7,9-14,20,45-46H,16-19H2,1H3 |
| InChIKey | VCERNLLOUCLSCK-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.74 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|