About N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine
N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine (PubChem CID 169491020) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine |
| PubChem CID | 169491020 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine |
| SMILES | CC=C=CN(C)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H17NO2S/c1-3-4-7-11(2)10-5-8-14(12,13)9-6-10/h3,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | IVNADMIGBJJJFW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine?
The IUPAC name of N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine (CID 169491020) is N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine.
What is the SMILES notation for N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine?
The canonical SMILES for N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine is CC=C=CN(C)C1CCS(=O)(=O)CC1.
What is the InChIKey of N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine?
The InChIKey is IVNADMIGBJJJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-3-4-7-11(2)10-5-8-14(12,13)9-6-10/h3,7,10H,5-6,8-9H2,1-2H3.
What are the key properties of N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine?
N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine has a molecular weight of 215.32 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,2-dienyl-N-methyl-1,1-dioxothian-4-amine is sourced from PubChem (CID 169491020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).