C19H28N4O5S — CID 169491437
5-[(6,7-dimethoxy-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)methyl]-2,3-dihydroindole-1-sulfonamide (PubChem CID 169491437) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 5-[(6,7-dimethoxy-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)methyl]-2,3-dihydroindole-1-sulfonamide.
| Compound Name | 5-[(6,7-dimethoxy-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)methyl]-2,3-dihydroindole-1-sulfonamide |
|---|---|
| PubChem CID | 169491437 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 5-[(6,7-dimethoxy-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)methyl]-2,3-dihydroindole-1-sulfonamide |
| SMILES | COC1CC2C(=O)NNC(Cc3ccc4c(c3)CCN4S(N)(=O)=O)C2CC1OC |
| InChI | InChI=1S/C19H28N4O5S/c1-27-17-9-13-14(10-18(17)28-2)19(24)22-21-15(13)8-11-3-4-16-12(7-11)5-6-23(16)29(20,25)26/h3-4,7,13-15,17-18,21H,5-6,8-10H2,1-2H3,(H,22,24)(H2,20,25,26) |
| InChIKey | GEMAYXWOLXRQDH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |