C30H41NO7 — CID 169491497
[(3S,6Z,8R,9S,10Z,12S,13R,14S,15S)-9-acetyloxy-3-benzyl-4,8,10,12,14,15-hexamethyl-2,5-dioxo-1-oxa-4-azacyclopentadeca-6,10-dien-13-yl] acetate (PubChem CID 169491497) has the molecular formula C30H41NO7 and a molecular weight of 527.66 g/mol. Its IUPAC name is [(3S,6Z,8R,9S,10Z,12S,13R,14S,15S)-9-acetyloxy-3-benzyl-4,8,10,12,14,15-hexamethyl-2,5-dioxo-1-oxa-4-azacyclopentadeca-6,10-dien-13-yl] acetate.
| Compound Name | [(3S,6Z,8R,9S,10Z,12S,13R,14S,15S)-9-acetyloxy-3-benzyl-4,8,10,12,14,15-hexamethyl-2,5-dioxo-1-oxa-4-azacyclopentadeca-6,10-dien-13-yl] acetate |
|---|---|
| PubChem CID | 169491497 |
| Molecular Formula | C30H41NO7 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | [(3S,6Z,8R,9S,10Z,12S,13R,14S,15S)-9-acetyloxy-3-benzyl-4,8,10,12,14,15-hexamethyl-2,5-dioxo-1-oxa-4-azacyclopentadeca-6,10-dien-13-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](C)[C@H](C)OC(=O)[C@H](Cc2ccccc2)N(C)C(=O)/C=C\[C@@H](C)[C@H](OC(C)=O)/C(C)=C\[C@@H]1C |
| InChI | InChI=1S/C30H41NO7/c1-18-14-15-27(34)31(8)26(17-25-12-10-9-11-13-25)30(35)36-22(5)21(4)29(38-24(7)33)20(3)16-19(2)28(18)37-23(6)32/h9-16,18,20-22,26,28-29H,17H2,1-8H3/b15-14-,19-16-/t18-,20+,21+,22+,26+,28+,29-/m1/s1 |
| InChIKey | PZHLTQDNBGDHKR-FLZVAEBXSA-N |
| XLogP | 4.28 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|