About (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one
(3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one (PubChem CID 169491606) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one |
| PubChem CID | 169491606 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one |
| SMILES | COc1c(C)c(O)cc2c1[C@@H](O)CC2=O |
| InChI | InChI=1S/C11H12O4/c1-5-7(12)3-6-8(13)4-9(14)10(6)11(5)15-2/h3,9,12,14H,4H2,1-2H3/t9-/m0/s1 |
| InChIKey | ZRVBCQIYHYRHIB-VIFPVBQESA-N |
| XLogP | 1.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one?
The IUPAC name of (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one (CID 169491606) is (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one.
What is the SMILES notation for (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one?
The canonical SMILES for (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one is COc1c(C)c(O)cc2c1[C@@H](O)CC2=O.
What is the InChIKey of (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one?
The InChIKey is ZRVBCQIYHYRHIB-VIFPVBQESA-N. The full InChI is InChI=1S/C11H12O4/c1-5-7(12)3-6-8(13)4-9(14)10(6)11(5)15-2/h3,9,12,14H,4H2,1-2H3/t9-/m0/s1.
What are the key properties of (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one?
(3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one has a molecular weight of 208.21 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,6-dihydroxy-4-methoxy-5-methyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 169491606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).