C27H31NO5 — CID 169491738
(1R,2E,4Z,6Z,11R,12Z,14E,16Z,18Z,20E,25S,26S)-25,26-dihydroxy-1,11-dimethyl-27-oxa-9-azabicyclo[22.2.1]heptacosa-2,4,6,12,14,16,18,20,23-nonaene-8,22-dione (PubChem CID 169491738) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (1R,2E,4Z,6Z,11R,12Z,14E,16Z,18Z,20E,25S,26S)-25,26-dihydroxy-1,11-dimethyl-27-oxa-9-azabicyclo[22.2.1]heptacosa-2,4,6,12,14,16,18,20,23-nonaene-8,22-dione.
| Compound Name | (1R,2E,4Z,6Z,11R,12Z,14E,16Z,18Z,20E,25S,26S)-25,26-dihydroxy-1,11-dimethyl-27-oxa-9-azabicyclo[22.2.1]heptacosa-2,4,6,12,14,16,18,20,23-nonaene-8,22-dione |
|---|---|
| PubChem CID | 169491738 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (1R,2E,4Z,6Z,11R,12Z,14E,16Z,18Z,20E,25S,26S)-25,26-dihydroxy-1,11-dimethyl-27-oxa-9-azabicyclo[22.2.1]heptacosa-2,4,6,12,14,16,18,20,23-nonaene-8,22-dione |
| SMILES | C[C@@H]1/C=C\C=C\C=C/C=C\C=C\C(=O)C=C2O[C@](C)(/C=C/C=C\C=C/C(=O)NC1)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C27H31NO5/c1-21-15-11-7-5-3-4-6-8-12-16-22(29)19-23-25(31)26(32)27(2,33-23)18-14-10-9-13-17-24(30)28-20-21/h3-19,21,25-26,31-32H,20H2,1-2H3,(H,28,30)/b4-3-,7-5+,8-6-,10-9-,15-11-,16-12+,17-13-,18-14+,23-19?/t21-,25-,26+,27-/m1/s1 |
| InChIKey | WMJODBDPGQNYNL-OBSDRQQESA-N |
| XLogP | 3.17 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |