C22H28O7 — CID 169491850
(2R,9R,10R)-10-butyl-9-hydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone (PubChem CID 169491850) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (2R,9R,10R)-10-butyl-9-hydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone.
| Compound Name | (2R,9R,10R)-10-butyl-9-hydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 169491850 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (2R,9R,10R)-10-butyl-9-hydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
| SMILES | CCCCC[C@@H]1CC2=C(C(=O)OC2=O)[C@H](O)[C@H](CCCC)CC2=C1C(=O)OC2=O |
| InChI | InChI=1S/C22H28O7/c1-3-5-7-9-12-10-15-17(22(27)29-20(15)25)18(23)13(8-6-4-2)11-14-16(12)21(26)28-19(14)24/h12-13,18,23H,3-11H2,1-2H3/t12-,13-,18-/m1/s1 |
| InChIKey | HKYNBSGRGJTECC-SNUQEOBHSA-N |
| XLogP | 2.90 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|