C17H22N2O6S2 — CID 16949186
diethyl 2-[(2-acetylsulfanylacetyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 16949186) has the molecular formula C17H22N2O6S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is diethyl 2-[(2-acetylsulfanylacetyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | diethyl 2-[(2-acetylsulfanylacetyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 16949186 |
| Molecular Formula | C17H22N2O6S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | diethyl 2-[(2-acetylsulfanylacetyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSC(C)=O)sc2c1CCN(C(=O)OCC)C2 |
| InChI | InChI=1S/C17H22N2O6S2/c1-4-24-16(22)14-11-6-7-19(17(23)25-5-2)8-12(11)27-15(14)18-13(21)9-26-10(3)20/h4-9H2,1-3H3,(H,18,21) |
| InChIKey | LJWDFWSXXKBJBT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|