C20H24O8 — CID 169492229
(4E,6E,10E)-12-[5-(carboxymethyl)-2,4-dioxooxolan-3-ylidene]-12-hydroxy-3,11-dimethyldodeca-4,6,10-trienoic acid (PubChem CID 169492229) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is (4E,6E,10E)-12-[5-(carboxymethyl)-2,4-dioxooxolan-3-ylidene]-12-hydroxy-3,11-dimethyldodeca-4,6,10-trienoic acid.
| Compound Name | (4E,6E,10E)-12-[5-(carboxymethyl)-2,4-dioxooxolan-3-ylidene]-12-hydroxy-3,11-dimethyldodeca-4,6,10-trienoic acid |
|---|---|
| PubChem CID | 169492229 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (4E,6E,10E)-12-[5-(carboxymethyl)-2,4-dioxooxolan-3-ylidene]-12-hydroxy-3,11-dimethyldodeca-4,6,10-trienoic acid |
| SMILES | C/C(=C\CC/C=C/C=C/C(C)CC(=O)O)C(O)=C1C(=O)OC(CC(=O)O)C1=O |
| InChI | InChI=1S/C20H24O8/c1-12(10-15(21)22)8-6-4-3-5-7-9-13(2)18(25)17-19(26)14(11-16(23)24)28-20(17)27/h3-4,6,8-9,12,14,25H,5,7,10-11H2,1-2H3,(H,21,22)(H,23,24)/b4-3+,8-6+,13-9+,18-17? |
| InChIKey | FWMYBLLQXTWTSA-LOLXGLIZSA-N |
| XLogP | 2.72 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|