C20H26O7 — CID 169492231
2-[4-[(2E,6E,8E)-1,12-dihydroxy-2,10-dimethyldodeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetic acid (PubChem CID 169492231) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 2-[4-[(2E,6E,8E)-1,12-dihydroxy-2,10-dimethyldodeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetic acid.
| Compound Name | 2-[4-[(2E,6E,8E)-1,12-dihydroxy-2,10-dimethyldodeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 169492231 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[4-[(2E,6E,8E)-1,12-dihydroxy-2,10-dimethyldodeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetic acid |
| SMILES | C/C(=C\CC/C=C/C=C/C(C)CCO)C(O)=C1C(=O)OC(CC(=O)O)C1=O |
| InChI | InChI=1S/C20H26O7/c1-13(10-11-21)8-6-4-3-5-7-9-14(2)18(24)17-19(25)15(12-16(22)23)27-20(17)26/h3-4,6,8-9,13,15,21,24H,5,7,10-12H2,1-2H3,(H,22,23)/b4-3+,8-6+,14-9+,18-17? |
| InChIKey | DVCGLTBTPWCXIR-CDOOKICMSA-N |
| XLogP | 2.63 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|