C12H20O6 — CID 169492344
(3R,4S,5R)-5-[(3R,4R,5S)-4,5-dihydroxy-3,5-dimethyloxolan-2-yl]-4-hydroxy-3,5-dimethyloxolan-2-one (PubChem CID 169492344) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (3R,4S,5R)-5-[(3R,4R,5S)-4,5-dihydroxy-3,5-dimethyloxolan-2-yl]-4-hydroxy-3,5-dimethyloxolan-2-one.
| Compound Name | (3R,4S,5R)-5-[(3R,4R,5S)-4,5-dihydroxy-3,5-dimethyloxolan-2-yl]-4-hydroxy-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 169492344 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3R,4S,5R)-5-[(3R,4R,5S)-4,5-dihydroxy-3,5-dimethyloxolan-2-yl]-4-hydroxy-3,5-dimethyloxolan-2-one |
| SMILES | C[C@H]1C(=O)O[C@@](C)(C2O[C@](C)(O)[C@H](O)[C@H]2C)[C@H]1O |
| InChI | InChI=1S/C12H20O6/c1-5-8(14)12(4,16)17-9(5)11(3)7(13)6(2)10(15)18-11/h5-9,13-14,16H,1-4H3/t5-,6-,7+,8-,9?,11-,12+/m1/s1 |
| InChIKey | AVAWQJCEESYVCC-SQLZSLSKSA-N |
| XLogP | -0.60 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |