4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid

C14H23NO3 — CID 169492382

IUPAC4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid
SMILESCCCCCCCc1cc(CCCC(=O)O)no1
InChIInChI=1S/C14H23NO3/c1-2-3-4-5-6-9-13-11-12(15-18-13)8-7-10-14(16)17/h11H,2-10H2,1H3,(H,16,17)
InChIKeyCUALQTIVAOUYKB-UHFFFAOYSA-N
MW253.34 g/mol
LogP3.59
Rot. Bonds10

About 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid

4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid (PubChem CID 169492382) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid
PubChem CID169492382
Molecular FormulaC14H23NO3
Molecular Weight253.34 g/mol
Exact Mass253.17
IUPAC Name4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid
SMILESCCCCCCCc1cc(CCCC(=O)O)no1
InChIInChI=1S/C14H23NO3/c1-2-3-4-5-6-9-13-11-12(15-18-13)8-7-10-14(16)17/h11H,2-10H2,1H3,(H,16,17)
InChIKeyCUALQTIVAOUYKB-UHFFFAOYSA-N
XLogP3.59
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.34
LogP ≤ 53.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
The IUPAC name of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid (CID 169492382) is 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid.
What is the SMILES notation for 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
The canonical SMILES for 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid is CCCCCCCc1cc(CCCC(=O)O)no1.
What is the InChIKey of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
The InChIKey is CUALQTIVAOUYKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-2-3-4-5-6-9-13-11-12(15-18-13)8-7-10-14(16)17/h11H,2-10H2,1H3,(H,16,17).
What are the key properties of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid has a molecular weight of 253.34 g/mol, XLogP of 3.59, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid is sourced from PubChem (CID 169492382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).