About 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid
4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid (PubChem CID 169492382) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid |
| PubChem CID | 169492382 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid |
| SMILES | CCCCCCCc1cc(CCCC(=O)O)no1 |
| InChI | InChI=1S/C14H23NO3/c1-2-3-4-5-6-9-13-11-12(15-18-13)8-7-10-14(16)17/h11H,2-10H2,1H3,(H,16,17) |
| InChIKey | CUALQTIVAOUYKB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
The IUPAC name of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid (CID 169492382) is 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid.
What is the SMILES notation for 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
The canonical SMILES for 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid is CCCCCCCc1cc(CCCC(=O)O)no1.
What is the InChIKey of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
The InChIKey is CUALQTIVAOUYKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-2-3-4-5-6-9-13-11-12(15-18-13)8-7-10-14(16)17/h11H,2-10H2,1H3,(H,16,17).
What are the key properties of 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid?
4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid has a molecular weight of 253.34 g/mol, XLogP of 3.59, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-heptyl-1,2-oxazol-3-yl)butanoic acid is sourced from PubChem (CID 169492382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).