C40H32O9S — CID 169492392
1-hydroxy-8-methoxy-3-methyl-6-[[(3R,7R,12S)-3,7,12-trihydroxy-8-methoxy-3-methyl-1-oxo-2,4,7,12-tetrahydrobenzo[a]anthracen-6-yl]sulfanyl]benzo[a]anthracene-7,12-dione (PubChem CID 169492392) has the molecular formula C40H32O9S and a molecular weight of 688.75 g/mol. Its IUPAC name is 1-hydroxy-8-methoxy-3-methyl-6-[[(3R,7R,12S)-3,7,12-trihydroxy-8-methoxy-3-methyl-1-oxo-2,4,7,12-tetrahydrobenzo[a]anthracen-6-yl]sulfanyl]benzo[a]anthracene-7,12-dione.
| Compound Name | 1-hydroxy-8-methoxy-3-methyl-6-[[(3R,7R,12S)-3,7,12-trihydroxy-8-methoxy-3-methyl-1-oxo-2,4,7,12-tetrahydrobenzo[a]anthracen-6-yl]sulfanyl]benzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 169492392 |
| Molecular Formula | C40H32O9S |
| Molecular Weight | 688.75 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | 1-hydroxy-8-methoxy-3-methyl-6-[[(3R,7R,12S)-3,7,12-trihydroxy-8-methoxy-3-methyl-1-oxo-2,4,7,12-tetrahydrobenzo[a]anthracen-6-yl]sulfanyl]benzo[a]anthracene-7,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(Sc3cc4c(c5c3[C@H](O)c3c(OC)cccc3[C@@H]5O)C(=O)C[C@](C)(O)C4)cc3cc(C)cc(O)c3c1C2=O |
| InChI | InChI=1S/C40H32O9S/c1-17-11-18-13-26(32-34(28(18)22(41)12-17)36(43)20-7-5-9-24(48-3)30(20)38(32)45)50-27-14-19-15-40(2,47)16-23(42)29(19)35-33(27)39(46)31-21(37(35)44)8-6-10-25(31)49-4/h5-14,37,39,41,44,46-47H,15-16H2,1-4H3/t37-,39+,40+/m0/s1 |
| InChIKey | YPXUBUQXYKPHFJ-DIPARAHXSA-N |
| XLogP | 6.15 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'} |
|---|