C23H28O6 — CID 169492419
[(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-8-oxoocta-2,4,6-trienoate (PubChem CID 169492419) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-8-oxoocta-2,4,6-trienoate.
| Compound Name | [(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-8-oxoocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 169492419 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [(5R,5aS,9aS,9bS)-9b-hydroxy-6,6,9a-trimethyl-1-oxo-3,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] (2E,4E,6E)-8-oxoocta-2,4,6-trienoate |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1[C@H](OC(=O)/C=C/C=C/C=C/C=O)C=C1COC(=O)[C@@]12O |
| InChI | InChI=1S/C23H28O6/c1-21(2)11-9-12-22(3)19(21)17(14-16-15-28-20(26)23(16,22)27)29-18(25)10-7-5-4-6-8-13-24/h4-8,10,13-14,17,19,27H,9,11-12,15H2,1-3H3/b5-4+,8-6+,10-7+/t17-,19+,22+,23+/m1/s1 |
| InChIKey | QBULWWZLNPVFLC-OFUOHYCUSA-N |
| XLogP | 2.83 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|