C19H24O6 — CID 169492587
(9S)-5,9-dihydroxy-8,8-dimethyl-4-pentyl-9,10-dihydro-4H-pyrano[4,3-f]chromene-2,6-dione (PubChem CID 169492587) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is (9S)-5,9-dihydroxy-8,8-dimethyl-4-pentyl-9,10-dihydro-4H-pyrano[4,3-f]chromene-2,6-dione.
| Compound Name | (9S)-5,9-dihydroxy-8,8-dimethyl-4-pentyl-9,10-dihydro-4H-pyrano[4,3-f]chromene-2,6-dione |
|---|---|
| PubChem CID | 169492587 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (9S)-5,9-dihydroxy-8,8-dimethyl-4-pentyl-9,10-dihydro-4H-pyrano[4,3-f]chromene-2,6-dione |
| SMILES | CCCCCC1OC(=O)C=C2C3=C(OC(C)(C)[C@@H](O)C3)C(=O)C(O)=C21 |
| InChI | InChI=1S/C19H24O6/c1-4-5-6-7-12-15-10(9-14(21)24-12)11-8-13(20)19(2,3)25-18(11)17(23)16(15)22/h9,12-13,20,22H,4-8H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | MSKBTPDAGAUXRU-ABLWVSNPSA-N |
| XLogP | 2.63 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|