C25H40 — CID 169492836
(1E,5E,9E,12R)-1,5,9-trimethyl-12-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclotetradeca-1,5,9-triene (PubChem CID 169492836) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (1E,5E,9E,12R)-1,5,9-trimethyl-12-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclotetradeca-1,5,9-triene.
| Compound Name | (1E,5E,9E,12R)-1,5,9-trimethyl-12-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclotetradeca-1,5,9-triene |
|---|---|
| PubChem CID | 169492836 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (1E,5E,9E,12R)-1,5,9-trimethyl-12-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclotetradeca-1,5,9-triene |
| SMILES | CC(C)=CC/C=C(\C)[C@H]1C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C25H40/c1-20(2)10-7-15-24(6)25-18-16-22(4)13-8-11-21(3)12-9-14-23(5)17-19-25/h10-11,14-16,25H,7-9,12-13,17-19H2,1-6H3/b21-11+,22-16+,23-14+,24-15+/t25-/m0/s1 |
| InChIKey | XAYAQYFQCPHHSL-ZIDPCNJYSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|