About 5-(3-chlorophenyl)-2,3-difluoroaniline
5-(3-chlorophenyl)-2,3-difluoroaniline (PubChem CID 169493264) has the molecular formula C12H8ClF2N
and a molecular weight of 239.65 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2,3-difluoroaniline.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)-2,3-difluoroaniline |
| PubChem CID | 169493264 |
| Molecular Formula | C12H8ClF2N |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 5-(3-chlorophenyl)-2,3-difluoroaniline |
| SMILES | Nc1cc(-c2cccc(Cl)c2)cc(F)c1F |
| InChI | InChI=1S/C12H8ClF2N/c13-9-3-1-2-7(4-9)8-5-10(14)12(15)11(16)6-8/h1-6H,16H2 |
| InChIKey | WITGFPASFUGKIE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chlorophenyl)-2,3-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)-2,3-difluoroaniline?
The IUPAC name of 5-(3-chlorophenyl)-2,3-difluoroaniline (CID 169493264) is 5-(3-chlorophenyl)-2,3-difluoroaniline.
What is the SMILES notation for 5-(3-chlorophenyl)-2,3-difluoroaniline?
The canonical SMILES for 5-(3-chlorophenyl)-2,3-difluoroaniline is Nc1cc(-c2cccc(Cl)c2)cc(F)c1F.
What is the InChIKey of 5-(3-chlorophenyl)-2,3-difluoroaniline?
The InChIKey is WITGFPASFUGKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClF2N/c13-9-3-1-2-7(4-9)8-5-10(14)12(15)11(16)6-8/h1-6H,16H2.
What are the key properties of 5-(3-chlorophenyl)-2,3-difluoroaniline?
5-(3-chlorophenyl)-2,3-difluoroaniline has a molecular weight of 239.65 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)-2,3-difluoroaniline is sourced from PubChem (CID 169493264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).