C33H34F2N3O6Si+ — CID 169494305
[10-[2-carboxy-5-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-7-[2-fluoroethyl(methyl)amino]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-(2-fluoroethyl)-methylazanium (PubChem CID 169494305) has the molecular formula C33H34F2N3O6Si+ and a molecular weight of 634.73 g/mol. Its IUPAC name is [10-[2-carboxy-5-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-7-[2-fluoroethyl(methyl)amino]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-(2-fluoroethyl)-methylazanium.
| Compound Name | [10-[2-carboxy-5-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-7-[2-fluoroethyl(methyl)amino]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-(2-fluoroethyl)-methylazanium |
|---|---|
| PubChem CID | 169494305 |
| Molecular Formula | C33H34F2N3O6Si+ |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | [10-[2-carboxy-5-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-7-[2-fluoroethyl(methyl)amino]-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-(2-fluoroethyl)-methylazanium |
| SMILES | CN(CCF)c1ccc2c(c1)[Si](C)(C)C1=C/C(=[N+](\C)CCF)C=CC1=C2c1cc(C(=O)ON2C(=O)CCC2=O)ccc1C(=O)O |
| InChI | InChI=1S/C33H33F2N3O6Si/c1-36(15-13-34)21-6-9-24-27(18-21)45(3,4)28-19-22(37(2)16-14-35)7-10-25(28)31(24)26-17-20(5-8-23(26)32(41)42)33(43)44-38-29(39)11-12-30(38)40/h5-10,17-19H,11-16H2,1-4H3/p+1 |
| InChIKey | LEIQFAXSNNHBNV-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|