C19H29NO2 — CID 169495150
tert-butyl 3-(4-tert-butylphenyl)pyrrolidine-1-carboxylate (PubChem CID 169495150) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is tert-butyl 3-(4-tert-butylphenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-tert-butylphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169495150 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | tert-butyl 3-(4-tert-butylphenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C19H29NO2/c1-18(2,3)16-9-7-14(8-10-16)15-11-12-20(13-15)17(21)22-19(4,5)6/h7-10,15H,11-13H2,1-6H3 |
| InChIKey | NSUOQQABBRRTGW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |