C12H18N2O — CID 169498714
3-cyclohexyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole (PubChem CID 169498714) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-cyclohexyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole.
| Compound Name | 3-cyclohexyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
|---|---|
| PubChem CID | 169498714 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-cyclohexyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
| SMILES | C1CCC(c2n[nH]c3c2COCC3)CC1 |
| InChI | InChI=1S/C12H18N2O/c1-2-4-9(5-3-1)12-10-8-15-7-6-11(10)13-14-12/h9H,1-8H2,(H,13,14) |
| InChIKey | MDMLZJQRTMDHRN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |