C8H7N7S2 — CID 169499194
5-methylsulfanyl-2-(1,3-thiazol-4-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 169499194) has the molecular formula C8H7N7S2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 5-methylsulfanyl-2-(1,3-thiazol-4-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-methylsulfanyl-2-(1,3-thiazol-4-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 169499194 |
| Molecular Formula | C8H7N7S2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 5-methylsulfanyl-2-(1,3-thiazol-4-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | CSc1nc(N)n2nc(-c3cscn3)nc2n1 |
| InChI | InChI=1S/C8H7N7S2/c1-16-8-12-6(9)15-7(13-8)11-5(14-15)4-2-17-3-10-4/h2-3H,1H3,(H2,9,11,12,13,14) |
| InChIKey | ADLDOYKCKOFAQK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |