About N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide
N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide (PubChem CID 16953454) has the molecular formula C14H12FN3O
and a molecular weight of 257.27 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide.
Molecular Properties
| Compound Name | N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide |
| PubChem CID | 16953454 |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide |
| SMILES | O=C(Nc1ncnc2c1CCC2)c1cccc(F)c1 |
| InChI | InChI=1S/C14H12FN3O/c15-10-4-1-3-9(7-10)14(19)18-13-11-5-2-6-12(11)16-8-17-13/h1,3-4,7-8H,2,5-6H2,(H,16,17,18,19) |
| InChIKey | BSXORRCXBLZOEB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide?
The IUPAC name of N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide (CID 16953454) is N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide.
What is the SMILES notation for N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide?
The canonical SMILES for N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide is O=C(Nc1ncnc2c1CCC2)c1cccc(F)c1.
What is the InChIKey of N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide?
The InChIKey is BSXORRCXBLZOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O/c15-10-4-1-3-9(7-10)14(19)18-13-11-5-2-6-12(11)16-8-17-13/h1,3-4,7-8H,2,5-6H2,(H,16,17,18,19).
What are the key properties of N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide?
N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide has a molecular weight of 257.27 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-3-fluorobenzamide is sourced from PubChem (CID 16953454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).