C12H20ClN — CID 16956080
4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine;hydrochloride (PubChem CID 16956080) has the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. Its IUPAC name is 4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine;hydrochloride.
| Compound Name | 4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine;hydrochloride |
|---|---|
| PubChem CID | 16956080 |
| Molecular Formula | C12H20ClN |
| Molecular Weight | 213.75 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine;hydrochloride |
| SMILES | C=CCC1C=C(C)CC(CC=C)N1.Cl |
| InChI | InChI=1S/C12H19N.ClH/c1-4-6-11-8-10(3)9-12(13-11)7-5-2;/h4-5,8,11-13H,1-2,6-7,9H2,3H3;1H |
| InChIKey | UIYVFONBMVMYTN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|