C19H18F3N3O2S — CID 16957371
4-[[3-cyano-6-methyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(3-methoxyphenyl)butanamide (PubChem CID 16957371) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 4-[[3-cyano-6-methyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(3-methoxyphenyl)butanamide.
| Compound Name | 4-[[3-cyano-6-methyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(3-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 16957371 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[[3-cyano-6-methyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(3-methoxyphenyl)butanamide |
| SMILES | COc1cccc(NC(=O)CCCSc2nc(C)cc(C(F)(F)F)c2C#N)c1 |
| InChI | InChI=1S/C19H18F3N3O2S/c1-12-9-16(19(20,21)22)15(11-23)18(24-12)28-8-4-7-17(26)25-13-5-3-6-14(10-13)27-2/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,25,26) |
| InChIKey | QGWPJTGLIAOONL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|