About N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide
N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide (PubChem CID 16957630) has the molecular formula C10H21NO4S2
and a molecular weight of 283.41 g/mol. Its IUPAC name is N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide |
| PubChem CID | 16957630 |
| Molecular Formula | C10H21NO4S2 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide |
| SMILES | CCCCCN(C)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO4S2/c1-3-4-5-7-11(2)17(14,15)10-6-8-16(12,13)9-10/h10H,3-9H2,1-2H3 |
| InChIKey | BGEGIMMFZAIEQW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide?
The IUPAC name of N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide (CID 16957630) is N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide.
What is the SMILES notation for N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide?
The canonical SMILES for N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide is CCCCCN(C)S(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide?
The InChIKey is BGEGIMMFZAIEQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4S2/c1-3-4-5-7-11(2)17(14,15)10-6-8-16(12,13)9-10/h10H,3-9H2,1-2H3.
What are the key properties of N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide?
N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide has a molecular weight of 283.41 g/mol, XLogP of 0.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,1-dioxo-N-pentylthiolane-3-sulfonamide is sourced from PubChem (CID 16957630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).