About 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide
1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide (PubChem CID 16958018) has the molecular formula C7H10N2O4S3
and a molecular weight of 282.37 g/mol. Its IUPAC name is 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide.
Molecular Properties
| Compound Name | 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide |
| PubChem CID | 16958018 |
| Molecular Formula | C7H10N2O4S3 |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2nccs2)C1 |
| InChI | InChI=1S/C7H10N2O4S3/c10-15(11)4-1-6(5-15)16(12,13)9-7-8-2-3-14-7/h2-3,6H,1,4-5H2,(H,8,9) |
| InChIKey | FOSOXLVRLSXDNS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide?
The IUPAC name of 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide (CID 16958018) is 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide.
What is the SMILES notation for 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide?
The canonical SMILES for 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide is O=S1(=O)CCC(S(=O)(=O)Nc2nccs2)C1.
What is the InChIKey of 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide?
The InChIKey is FOSOXLVRLSXDNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4S3/c10-15(11)4-1-6(5-15)16(12,13)9-7-8-2-3-14-7/h2-3,6H,1,4-5H2,(H,8,9).
What are the key properties of 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide?
1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide has a molecular weight of 282.37 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-N-(1,3-thiazol-2-yl)thiolane-3-sulfonamide is sourced from PubChem (CID 16958018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).