About 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol
1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol (PubChem CID 16958272) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol |
| PubChem CID | 16958272 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol |
| SMILES | CCCCOCC(O)CN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H29NO2/c1-4-5-6-17-11-14(16)10-15-8-12(2)7-13(3)9-15/h12-14,16H,4-11H2,1-3H3 |
| InChIKey | RUFPVBGMFJWXNM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol?
The IUPAC name of 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol (CID 16958272) is 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol.
What is the SMILES notation for 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol?
The canonical SMILES for 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol is CCCCOCC(O)CN1CC(C)CC(C)C1.
What is the InChIKey of 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol?
The InChIKey is RUFPVBGMFJWXNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-4-5-6-17-11-14(16)10-15-8-12(2)7-13(3)9-15/h12-14,16H,4-11H2,1-3H3.
What are the key properties of 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol?
1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol has a molecular weight of 243.39 g/mol, XLogP of 2.14, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-3-(3,5-dimethylpiperidin-1-yl)propan-2-ol is sourced from PubChem (CID 16958272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).