C19H35F2NO — CID 169584855
N-[1-(difluoromethyl)cyclopropyl]-2-hexyl-2-methyloctanamide (PubChem CID 169584855) has the molecular formula C19H35F2NO and a molecular weight of 331.50 g/mol. Its IUPAC name is N-[1-(difluoromethyl)cyclopropyl]-2-hexyl-2-methyloctanamide.
| Compound Name | N-[1-(difluoromethyl)cyclopropyl]-2-hexyl-2-methyloctanamide |
|---|---|
| PubChem CID | 169584855 |
| Molecular Formula | C19H35F2NO |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | N-[1-(difluoromethyl)cyclopropyl]-2-hexyl-2-methyloctanamide |
| SMILES | CCCCCCC(C)(CCCCCC)C(=O)NC1(CC1)C(F)F |
| InChI | InChI=1S/C19H35F2NO/c1-4-6-8-10-12-18(3,13-11-9-7-5-2)17(23)22-19(14-15-19)16(20)21/h16H,4-15H2,1-3H3,(H,22,23) |
| InChIKey | NMRBRUKIKHSTIU-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | 341 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|