About [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate
[2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (PubChem CID 16959176) has the molecular formula C19H13FN2O5S2
and a molecular weight of 432.45 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| PubChem CID | 16959176 |
| Molecular Formula | C19H13FN2O5S2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc([N+](=O)[O-])cc2C(=O)OCC(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H13FN2O5S2/c1-11-10-28-19(21-11)29-17-7-6-14(22(25)26)8-15(17)18(24)27-9-16(23)12-2-4-13(20)5-3-12/h2-8,10H,9H2,1H3 |
| InChIKey | YGUULYGKSDCGAM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate?
The IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate (CID 16959176) is [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate.
What is the SMILES notation for [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate?
The canonical SMILES for [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate is Cc1csc(Sc2ccc([N+](=O)[O-])cc2C(=O)OCC(=O)c2ccc(F)cc2)n1.
What is the InChIKey of [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate?
The InChIKey is YGUULYGKSDCGAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13FN2O5S2/c1-11-10-28-19(21-11)29-17-7-6-14(22(25)26)8-15(17)18(24)27-9-16(23)12-2-4-13(20)5-3-12/h2-8,10H,9H2,1H3.
What are the key properties of [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate?
[2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate has a molecular weight of 432.45 g/mol, XLogP of 4.69, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)-2-oxoethyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitrobenzoate is sourced from PubChem (CID 16959176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).