C16H14ClN5O4S — CID 16960410
(2-chloro-4-nitrophenyl) 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate (PubChem CID 16960410) has the molecular formula C16H14ClN5O4S and a molecular weight of 407.84 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate.
| Compound Name | (2-chloro-4-nitrophenyl) 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 16960410 |
| Molecular Formula | C16H14ClN5O4S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (2-chloro-4-nitrophenyl) 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
| SMILES | CSc1nc2nc(C)c(CC(=O)Oc3ccc([N+](=O)[O-])cc3Cl)c(C)n2n1 |
| InChI | InChI=1S/C16H14ClN5O4S/c1-8-11(9(2)21-15(18-8)19-16(20-21)27-3)7-14(23)26-13-5-4-10(22(24)25)6-12(13)17/h4-6H,7H2,1-3H3 |
| InChIKey | DRNCPNASYHYFCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|