C25H25ClN4O4 — CID 16961179
2-[[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 16961179) has the molecular formula C25H25ClN4O4 and a molecular weight of 480.95 g/mol. Its IUPAC name is 2-[[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 2-[[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 16961179 |
| Molecular Formula | C25H25ClN4O4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccccc2NC(=O)CN(C)Cc2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C25H25ClN4O4/c1-17-7-9-18(10-8-17)14-27-25(32)21-5-3-4-6-23(21)28-24(31)16-29(2)15-19-13-20(30(33)34)11-12-22(19)26/h3-13H,14-16H2,1-2H3,(H,27,32)(H,28,31) |
| InChIKey | KGDDWAUGVCDPSN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|