About [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate (PubChem CID 16961243) has the molecular formula C16H12N2O7
and a molecular weight of 344.28 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate.
Molecular Properties
| Compound Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate |
| PubChem CID | 16961243 |
| Molecular Formula | C16H12N2O7 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate |
| SMILES | COc1ccc(-c2cc(COC(=O)c3ccc([N+](=O)[O-])o3)on2)cc1 |
| InChI | InChI=1S/C16H12N2O7/c1-22-11-4-2-10(3-5-11)13-8-12(25-17-13)9-23-16(19)14-6-7-15(24-14)18(20)21/h2-8H,9H2,1H3 |
| InChIKey | FTOOYEBZNVKMGL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 117.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate?
The IUPAC name of [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate (CID 16961243) is [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate.
What is the SMILES notation for [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate?
The canonical SMILES for [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate is COc1ccc(-c2cc(COC(=O)c3ccc([N+](=O)[O-])o3)on2)cc1.
What is the InChIKey of [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate?
The InChIKey is FTOOYEBZNVKMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O7/c1-22-11-4-2-10(3-5-11)13-8-12(25-17-13)9-23-16(19)14-6-7-15(24-14)18(20)21/h2-8H,9H2,1H3.
What are the key properties of [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate?
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate has a molecular weight of 344.28 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 5-nitrofuran-2-carboxylate is sourced from PubChem (CID 16961243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).