C25H26N6O7 — CID 16961352
[2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate (PubChem CID 16961352) has the molecular formula C25H26N6O7 and a molecular weight of 522.52 g/mol. Its IUPAC name is [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 16961352 |
| Molecular Formula | C25H26N6O7 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
| SMILES | CN(C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H26N6O7/c1-28(21-22(26)30(25(35)27-23(21)33)14-16-7-3-2-4-8-16)20(32)15-38-24(34)18-13-17(31(36)37)9-10-19(18)29-11-5-6-12-29/h2-4,7-10,13H,5-6,11-12,14-15,26H2,1H3,(H,27,33,35) |
| InChIKey | SFGZQNYHIQPQTN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 173.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|