C18H18N4O6S2 — CID 16961600
N,N-diethyl-3-[5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide (PubChem CID 16961600) has the molecular formula C18H18N4O6S2 and a molecular weight of 450.50 g/mol. Its IUPAC name is N,N-diethyl-3-[5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 16961600 |
| Molecular Formula | C18H18N4O6S2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N,N-diethyl-3-[5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(S/C=C/c3ccc([N+](=O)[O-])o3)o2)c1 |
| InChI | InChI=1S/C18H18N4O6S2/c1-3-21(4-2)30(25,26)15-7-5-6-13(12-15)17-19-20-18(28-17)29-11-10-14-8-9-16(27-14)22(23)24/h5-12H,3-4H2,1-2H3/b11-10+ |
| InChIKey | VIEXEULFBMBREA-ZHACJKMWSA-N |
| XLogP | 4.03 |
| TPSA | 132.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|