C10H14BrN — CID 169623675
(2E,4E)-5-bromo-N-ethenyl-2,3-dimethylhexa-2,4-dien-1-imine (PubChem CID 169623675) has the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. Its IUPAC name is (2E,4E)-5-bromo-N-ethenyl-2,3-dimethylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4E)-5-bromo-N-ethenyl-2,3-dimethylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 169623675 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (2E,4E)-5-bromo-N-ethenyl-2,3-dimethylhexa-2,4-dien-1-imine |
| SMILES | C/C(=C\C(=C(/C)\C=NC=C)\C)/Br |
| InChI | InChI=1S/C10H14BrN/c1-5-12-7-9(3)8(2)6-10(4)11/h5-7H,1H2,2-4H3/b9-8+,10-6+,12-7? |
| InChIKey | PMWNUCQANHILCK-QLFLPRPASA-N |
| XLogP | 3.40 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 247 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|