C21H17N5O5 — CID 16962971
(E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 16962971) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is (E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 16962971 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C21H17N5O5/c1-24-8-9-25(21-20(24)22-14-4-2-3-5-15(14)23-21)19(27)7-6-13-10-17-18(31-12-30-17)11-16(13)26(28)29/h2-7,10-11H,8-9,12H2,1H3/b7-6+ |
| InChIKey | ODTLAXWFBNKPSD-VOTSOKGWSA-N |
| XLogP | 2.76 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|