C16H14N4O3S — CID 16963076
4-(2,4-dimethylphenyl)-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,2,4-triazole (PubChem CID 16963076) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,2,4-triazole.
| Compound Name | 4-(2,4-dimethylphenyl)-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 16963076 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanyl-1,2,4-triazole |
| SMILES | Cc1ccc(-n2cnnc2S/C=C/c2ccc([N+](=O)[O-])o2)c(C)c1 |
| InChI | InChI=1S/C16H14N4O3S/c1-11-3-5-14(12(2)9-11)19-10-17-18-16(19)24-8-7-13-4-6-15(23-13)20(21)22/h3-10H,1-2H3/b8-7+ |
| InChIKey | VMSNUQIIJZJSKS-BQYQJAHWSA-N |
| XLogP | 4.15 |
| TPSA | 86.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|