C25H22N4O6S2 — CID 16963736
2-[8,8-dimethyl-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide (PubChem CID 16963736) has the molecular formula C25H22N4O6S2 and a molecular weight of 538.61 g/mol. Its IUPAC name is 2-[8,8-dimethyl-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[8,8-dimethyl-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16963736 |
| Molecular Formula | C25H22N4O6S2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 2-[8,8-dimethyl-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2c3c(sc2=O)C(C)(C)C2C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C2S3)c1 |
| InChI | InChI=1S/C25H22N4O6S2/c1-13-5-4-6-14(11-13)26-17(30)12-27-23-20(37-24(27)33)25(2,3)18-19(36-23)22(32)28(21(18)31)15-7-9-16(10-8-15)29(34)35/h4-11,18-19H,12H2,1-3H3,(H,26,30) |
| InChIKey | BUHFALPELRGHAB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|