C27H30N4O2 — CID 16963861
N-[1-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-3-carboxamide (PubChem CID 16963861) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[1-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[1-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16963861 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-[1-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(OCCCCn2c(C(C)NC(=O)c3cccnc3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C27H30N4O2/c1-19-12-13-23(17-20(19)2)33-16-7-6-15-31-25-11-5-4-10-24(25)30-26(31)21(3)29-27(32)22-9-8-14-28-18-22/h4-5,8-14,17-18,21H,6-7,15-16H2,1-3H3,(H,29,32) |
| InChIKey | ZKLGQJJULSSJBK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|