C19H20N4O3 — CID 16964380
ethyl 2-[2-[2-(pyridine-3-carbonylamino)ethyl]benzimidazol-1-yl]acetate (PubChem CID 16964380) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 2-[2-[2-(pyridine-3-carbonylamino)ethyl]benzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(pyridine-3-carbonylamino)ethyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16964380 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | ethyl 2-[2-[2-(pyridine-3-carbonylamino)ethyl]benzimidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(CCNC(=O)c2cccnc2)nc2ccccc21 |
| InChI | InChI=1S/C19H20N4O3/c1-2-26-18(24)13-23-16-8-4-3-7-15(16)22-17(23)9-11-21-19(25)14-6-5-10-20-12-14/h3-8,10,12H,2,9,11,13H2,1H3,(H,21,25) |
| InChIKey | WRKQUNQLFPXQNT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |